About ethane;2-[3-[9-(2-prop-2-enoyloxyethyl)carbazol-1-yl]carbazol-9-yl]ethyl prop-2-enoate
ethane;2-[3-[9-(2-prop-2-enoyloxyethyl)carbazol-1-yl]carbazol-9-yl]ethyl prop-2-enoate (PubChem CID 157476790) has the molecular formula C38H40N2O4
and a molecular weight of 588.75 g/mol. Its IUPAC name is ethane;2-[3-[9-(2-prop-2-enoyloxyethyl)carbazol-1-yl]carbazol-9-yl]ethyl prop-2-enoate.
Molecular Properties
| Compound Name | ethane;2-[3-[9-(2-prop-2-enoyloxyethyl)carbazol-1-yl]carbazol-9-yl]ethyl prop-2-enoate |
| PubChem CID | 157476790 |
| Molecular Formula | C38H40N2O4 |
| Molecular Weight | 588.75 g/mol |
| Exact Mass | 588.30 |
| IUPAC Name | ethane;2-[3-[9-(2-prop-2-enoyloxyethyl)carbazol-1-yl]carbazol-9-yl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCn1c2ccccc2c2cc(-c3cccc4c5ccccc5n(CCOC(=O)C=C)c34)ccc21.CC.CC |
| InChI | InChI=1S/C34H28N2O4.2C2H6/c1-3-32(37)39-20-18-35-29-14-7-6-11-26(29)28-22-23(16-17-31(28)35)24-12-9-13-27-25-10-5-8-15-30(25)36(34(24)27)19-21-40-33(38)4-2;2*1-2/h3-17,22H,1-2,18-21H2;2*1-2H3 |
| InChIKey | BVRLTHLEQDUVDA-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 588.75 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-[3-[9-(2-prop-2-enoyloxyethyl)carbazol-1-yl]carbazol-9-yl]ethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-[3-[9-(2-prop-2-enoyloxyethyl)carbazol-1-yl]carbazol-9-yl]ethyl prop-2-enoate?
The IUPAC name of ethane;2-[3-[9-(2-prop-2-enoyloxyethyl)carbazol-1-yl]carbazol-9-yl]ethyl prop-2-enoate (CID 157476790) is ethane;2-[3-[9-(2-prop-2-enoyloxyethyl)carbazol-1-yl]carbazol-9-yl]ethyl prop-2-enoate.
What is the SMILES notation for ethane;2-[3-[9-(2-prop-2-enoyloxyethyl)carbazol-1-yl]carbazol-9-yl]ethyl prop-2-enoate?
The canonical SMILES for ethane;2-[3-[9-(2-prop-2-enoyloxyethyl)carbazol-1-yl]carbazol-9-yl]ethyl prop-2-enoate is C=CC(=O)OCCn1c2ccccc2c2cc(-c3cccc4c5ccccc5n(CCOC(=O)C=C)c34)ccc21.CC.CC.
What is the InChIKey of ethane;2-[3-[9-(2-prop-2-enoyloxyethyl)carbazol-1-yl]carbazol-9-yl]ethyl prop-2-enoate?
The InChIKey is BVRLTHLEQDUVDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H28N2O4.2C2H6/c1-3-32(37)39-20-18-35-29-14-7-6-11-26(29)28-22-23(16-17-31(28)35)24-12-9-13-27-25-10-5-8-15-30(25)36(34(24)27)19-21-40-33(38)4-2;2*1-2/h3-17,22H,1-2,18-21H2;2*1-2H3.
What are the key properties of ethane;2-[3-[9-(2-prop-2-enoyloxyethyl)carbazol-1-yl]carbazol-9-yl]ethyl prop-2-enoate?
ethane;2-[3-[9-(2-prop-2-enoyloxyethyl)carbazol-1-yl]carbazol-9-yl]ethyl prop-2-enoate has a molecular weight of 588.75 g/mol, XLogP of 9.08, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-[3-[9-(2-prop-2-enoyloxyethyl)carbazol-1-yl]carbazol-9-yl]ethyl prop-2-enoate is sourced from PubChem (CID 157476790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).