C22H18Cl2FN3O5S — CID 157477006
1-chloro-4-[(3R,4S)-1-(4-chloro-2-isocyanophenyl)sulfonyl-4-(3-fluoro-4-isocyanophenoxy)-3-hydroxypyrrolidin-3-yl]butan-2-one (PubChem CID 157477006) has the molecular formula C22H18Cl2FN3O5S and a molecular weight of 526.37 g/mol. Its IUPAC name is 1-chloro-4-[(3R,4S)-1-(4-chloro-2-isocyanophenyl)sulfonyl-4-(3-fluoro-4-isocyanophenoxy)-3-hydroxypyrrolidin-3-yl]butan-2-one.
| Compound Name | 1-chloro-4-[(3R,4S)-1-(4-chloro-2-isocyanophenyl)sulfonyl-4-(3-fluoro-4-isocyanophenoxy)-3-hydroxypyrrolidin-3-yl]butan-2-one |
|---|---|
| PubChem CID | 157477006 |
| Molecular Formula | C22H18Cl2FN3O5S |
| Molecular Weight | 526.37 g/mol |
| Exact Mass | 525.03 |
| IUPAC Name | 1-chloro-4-[(3R,4S)-1-(4-chloro-2-isocyanophenyl)sulfonyl-4-(3-fluoro-4-isocyanophenoxy)-3-hydroxypyrrolidin-3-yl]butan-2-one |
| SMILES | [C-]#[N+]c1ccc(O[C@H]2CN(S(=O)(=O)c3ccc(Cl)cc3[N+]#[C-])C[C@]2(O)CCC(=O)CCl)cc1F |
| InChI | InChI=1S/C22H18Cl2FN3O5S/c1-26-18-5-4-16(10-17(18)25)33-21-12-28(13-22(21,30)8-7-15(29)11-23)34(31,32)20-6-3-14(24)9-19(20)27-2/h3-6,9-10,21,30H,7-8,11-13H2/t21-,22+/m0/s1 |
| InChIKey | BVSDCDXRKPOGFD-FCHUYYIVSA-N |
| XLogP | 4.35 |
| TPSA | 92.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|