C27H27BCl2I2N2O2 — CID 157477658
2-chloro-5-iodopyridine;2-chloro-5-(2,4,6-trimethylphenyl)pyridine;(4-iodo-2,6-dimethylphenyl)boronic acid (PubChem CID 157477658) has the molecular formula C27H27BCl2I2N2O2 and a molecular weight of 747.05 g/mol. Its IUPAC name is 2-chloro-5-iodopyridine;2-chloro-5-(2,4,6-trimethylphenyl)pyridine;(4-iodo-2,6-dimethylphenyl)boronic acid.
| Compound Name | 2-chloro-5-iodopyridine;2-chloro-5-(2,4,6-trimethylphenyl)pyridine;(4-iodo-2,6-dimethylphenyl)boronic acid |
|---|---|
| PubChem CID | 157477658 |
| Molecular Formula | C27H27BCl2I2N2O2 |
| Molecular Weight | 747.05 g/mol |
| Exact Mass | 745.96 |
| IUPAC Name | 2-chloro-5-iodopyridine;2-chloro-5-(2,4,6-trimethylphenyl)pyridine;(4-iodo-2,6-dimethylphenyl)boronic acid |
| SMILES | Cc1cc(C)c(-c2ccc(Cl)nc2)c(C)c1.Cc1cc(I)cc(C)c1B(O)O.Clc1ccc(I)cn1 |
| InChI | InChI=1S/C14H14ClN.C8H10BIO2.C5H3ClIN/c1-9-6-10(2)14(11(3)7-9)12-4-5-13(15)16-8-12;1-5-3-7(10)4-6(2)8(5)9(11)12;6-5-2-1-4(7)3-8-5/h4-8H,1-3H3;3-4,11-12H,1-2H3;1-3H |
| InChIKey | BVUCFLZHPKDPCA-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.05 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|