C27H24ClFN2 — CID 155908905
2-[5-tert-butyl-2-[4-chloro-2-(3-methyl-2-pyridinyl)phenyl]phenyl]-5-fluoropyridine (PubChem CID 155908905) has the molecular formula C27H24ClFN2 and a molecular weight of 430.95 g/mol. Its IUPAC name is 2-[5-tert-butyl-2-[4-chloro-2-(3-methyl-2-pyridinyl)phenyl]phenyl]-5-fluoropyridine.
| Compound Name | 2-[5-tert-butyl-2-[4-chloro-2-(3-methyl-2-pyridinyl)phenyl]phenyl]-5-fluoropyridine |
|---|---|
| PubChem CID | 155908905 |
| Molecular Formula | C27H24ClFN2 |
| Molecular Weight | 430.95 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 2-[5-tert-butyl-2-[4-chloro-2-(3-methyl-2-pyridinyl)phenyl]phenyl]-5-fluoropyridine |
| SMILES | Cc1cccnc1-c1cc(Cl)ccc1-c1ccc(C(C)(C)C)cc1-c1ccc(F)cn1 |
| InChI | InChI=1S/C27H24ClFN2/c1-17-6-5-13-30-26(17)24-15-19(28)8-11-22(24)21-10-7-18(27(2,3)4)14-23(21)25-12-9-20(29)16-31-25/h5-16H,1-4H3 |
| InChIKey | GFPNPDIJNCOSCP-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.95 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |