C19H29NO4 — CID 157478712
tert-butyl 2-[3-amino-4-[2-(oxan-4-yl)ethyl]phenoxy]acetate (PubChem CID 157478712) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is tert-butyl 2-[3-amino-4-[2-(oxan-4-yl)ethyl]phenoxy]acetate.
| Compound Name | tert-butyl 2-[3-amino-4-[2-(oxan-4-yl)ethyl]phenoxy]acetate |
|---|---|
| PubChem CID | 157478712 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | tert-butyl 2-[3-amino-4-[2-(oxan-4-yl)ethyl]phenoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COc1ccc(CCC2CCOCC2)c(N)c1 |
| InChI | InChI=1S/C19H29NO4/c1-19(2,3)24-18(21)13-23-16-7-6-15(17(20)12-16)5-4-14-8-10-22-11-9-14/h6-7,12,14H,4-5,8-11,13,20H2,1-3H3 |
| InChIKey | BVXDGZKLLLZAEH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|