C24H19N5O — CID 157479031
1-[3-[2-(4-amino-7-pyridin-4-ylpyrrolo[2,3-d]pyrimidin-5-yl)ethynyl]phenyl]-2-cyclopropylethanone (PubChem CID 157479031) has the molecular formula C24H19N5O and a molecular weight of 393.45 g/mol. Its IUPAC name is 1-[3-[2-(4-amino-7-pyridin-4-ylpyrrolo[2,3-d]pyrimidin-5-yl)ethynyl]phenyl]-2-cyclopropylethanone.
| Compound Name | 1-[3-[2-(4-amino-7-pyridin-4-ylpyrrolo[2,3-d]pyrimidin-5-yl)ethynyl]phenyl]-2-cyclopropylethanone |
|---|---|
| PubChem CID | 157479031 |
| Molecular Formula | C24H19N5O |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 1-[3-[2-(4-amino-7-pyridin-4-ylpyrrolo[2,3-d]pyrimidin-5-yl)ethynyl]phenyl]-2-cyclopropylethanone |
| SMILES | Nc1ncnc2c1c(C#Cc1cccc(C(=O)CC3CC3)c1)cn2-c1ccncc1 |
| InChI | InChI=1S/C24H19N5O/c25-23-22-19(14-29(24(22)28-15-27-23)20-8-10-26-11-9-20)7-6-16-2-1-3-18(12-16)21(30)13-17-4-5-17/h1-3,8-12,14-15,17H,4-5,13H2,(H2,25,27,28) |
| InChIKey | BVYBMYSCMBZRTL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|