C11H11N3O6 — CID 157479221
3,5-dinitro-1H-indole;ethyl formate (PubChem CID 157479221) has the molecular formula C11H11N3O6 and a molecular weight of 281.22 g/mol. Its IUPAC name is 3,5-dinitro-1H-indole;ethyl formate.
| Compound Name | 3,5-dinitro-1H-indole;ethyl formate |
|---|---|
| PubChem CID | 157479221 |
| Molecular Formula | C11H11N3O6 |
| Molecular Weight | 281.22 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 3,5-dinitro-1H-indole;ethyl formate |
| SMILES | CCOC=O.O=[N+]([O-])c1ccc2[nH]cc([N+](=O)[O-])c2c1 |
| InChI | InChI=1S/C8H5N3O4.C3H6O2/c12-10(13)5-1-2-7-6(3-5)8(4-9-7)11(14)15;1-2-5-3-4/h1-4,9H;3H,2H2,1H3 |
| InChIKey | BVYQKRMGGWKASL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 128.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.22 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|