C13H17F6NO5 — CID 15748077
methyl (3R,4R,5S)-5-methyl-4-[(2,2,2-trifluoroacetyl)amino]-3-(2,2,2-trifluoroacetyl)oxyheptanoate (PubChem CID 15748077) has the molecular formula C13H17F6NO5 and a molecular weight of 381.27 g/mol. Its IUPAC name is methyl (3R,4R,5S)-5-methyl-4-[(2,2,2-trifluoroacetyl)amino]-3-(2,2,2-trifluoroacetyl)oxyheptanoate.
| Compound Name | methyl (3R,4R,5S)-5-methyl-4-[(2,2,2-trifluoroacetyl)amino]-3-(2,2,2-trifluoroacetyl)oxyheptanoate |
|---|---|
| PubChem CID | 15748077 |
| Molecular Formula | C13H17F6NO5 |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | methyl (3R,4R,5S)-5-methyl-4-[(2,2,2-trifluoroacetyl)amino]-3-(2,2,2-trifluoroacetyl)oxyheptanoate |
| SMILES | CC[C@H](C)[C@@H](NC(=O)C(F)(F)F)[C@@H](CC(=O)OC)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C13H17F6NO5/c1-4-6(2)9(20-10(22)12(14,15)16)7(5-8(21)24-3)25-11(23)13(17,18)19/h6-7,9H,4-5H2,1-3H3,(H,20,22)/t6-,7+,9+/m0/s1 |
| InChIKey | WGHFUJRCCWONSJ-LKEWCRSYSA-N |
| XLogP | 2.12 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |