C23H42NO+ — CID 15748169
(2S,4S)-1,1-dimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]piperidin-1-ium-4-ol (PubChem CID 15748169) has the molecular formula C23H42NO+ and a molecular weight of 348.60 g/mol. Its IUPAC name is (2S,4S)-1,1-dimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]piperidin-1-ium-4-ol.
| Compound Name | (2S,4S)-1,1-dimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]piperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 15748169 |
| Molecular Formula | C23H42NO+ |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.33 |
| IUPAC Name | (2S,4S)-1,1-dimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]piperidin-1-ium-4-ol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC[C@H]1C[C@@H](O)CC[N+]1(C)C |
| InChI | InChI=1S/C23H42NO/c1-19(2)10-7-11-20(3)12-8-13-21(4)14-9-15-22-18-23(25)16-17-24(22,5)6/h10,12,14,22-23,25H,7-9,11,13,15-18H2,1-6H3/q+1/b20-12+,21-14+/t22-,23-/m0/s1 |
| InChIKey | AGKVENVWHZOJBH-PFZPXMGDSA-N |
| XLogP | 5.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|