C28H50NO+ — CID 15748171
(2S,4S)-1,1-dimethyl-2-[(3E,7E,11E)-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]piperidin-1-ium-4-ol (PubChem CID 15748171) has the molecular formula C28H50NO+ and a molecular weight of 416.71 g/mol. Its IUPAC name is (2S,4S)-1,1-dimethyl-2-[(3E,7E,11E)-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]piperidin-1-ium-4-ol.
| Compound Name | (2S,4S)-1,1-dimethyl-2-[(3E,7E,11E)-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]piperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 15748171 |
| Molecular Formula | C28H50NO+ |
| Molecular Weight | 416.71 g/mol |
| Exact Mass | 416.39 |
| IUPAC Name | (2S,4S)-1,1-dimethyl-2-[(3E,7E,11E)-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]piperidin-1-ium-4-ol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CC[C@H]1C[C@@H](O)CC[N+]1(C)C |
| InChI | InChI=1S/C28H50NO/c1-23(2)12-10-15-25(4)17-11-16-24(3)13-8-9-14-26(5)18-19-27-22-28(30)20-21-29(27,6)7/h12-14,17,27-28,30H,8-11,15-16,18-22H2,1-7H3/q+1/b24-13+,25-17+,26-14+/t27-,28-/m0/s1 |
| InChIKey | CGTMXCJLKBSRFP-WHVOIROWSA-N |
| XLogP | 7.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.71 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|