C18H16IN3O — CID 157484375
N-(4-iodo-3-methylphenyl)-6-(2H-pyridin-1-yl)pyridine-3-carboxamide (PubChem CID 157484375) has the molecular formula C18H16IN3O and a molecular weight of 417.25 g/mol. Its IUPAC name is N-(4-iodo-3-methylphenyl)-6-(2H-pyridin-1-yl)pyridine-3-carboxamide.
| Compound Name | N-(4-iodo-3-methylphenyl)-6-(2H-pyridin-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 157484375 |
| Molecular Formula | C18H16IN3O |
| Molecular Weight | 417.25 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | N-(4-iodo-3-methylphenyl)-6-(2H-pyridin-1-yl)pyridine-3-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccc(N3C=CC=CC3)nc2)ccc1I |
| InChI | InChI=1S/C18H16IN3O/c1-13-11-15(6-7-16(13)19)21-18(23)14-5-8-17(20-12-14)22-9-3-2-4-10-22/h2-9,11-12H,10H2,1H3,(H,21,23) |
| InChIKey | BWNMXHUENNHTTF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.25 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|