C24H27ClN4O10S — CID 157485262
N-[2-[2-(4-chloro-N-methylanilino)ethylamino]ethyl]isoquinoline-5-sulfonamide;oxalic acid (PubChem CID 157485262) has the molecular formula C24H27ClN4O10S and a molecular weight of 599.02 g/mol. Its IUPAC name is N-[2-[2-(4-chloro-N-methylanilino)ethylamino]ethyl]isoquinoline-5-sulfonamide;oxalic acid.
| Compound Name | N-[2-[2-(4-chloro-N-methylanilino)ethylamino]ethyl]isoquinoline-5-sulfonamide;oxalic acid |
|---|---|
| PubChem CID | 157485262 |
| Molecular Formula | C24H27ClN4O10S |
| Molecular Weight | 599.02 g/mol |
| Exact Mass | 598.11 |
| IUPAC Name | N-[2-[2-(4-chloro-N-methylanilino)ethylamino]ethyl]isoquinoline-5-sulfonamide;oxalic acid |
| SMILES | CN(CCNCCNS(=O)(=O)c1cccc2cnccc12)c1ccc(Cl)cc1.O=C(O)C(=O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H23ClN4O2S.2C2H2O4/c1-25(18-7-5-17(21)6-8-18)14-13-22-11-12-24-28(26,27)20-4-2-3-16-15-23-10-9-19(16)20;2*3-1(4)2(5)6/h2-10,15,22,24H,11-14H2,1H3;2*(H,3,4)(H,5,6) |
| InChIKey | BWQGRAVRWWISJI-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 223.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.02 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|