C8H5F6IN4S2 — CID 157486988
5-iodo-4-(trifluoromethyl)-1,3-thiazol-2-amine;4-(trifluoromethyl)-1,3-thiazol-2-amine (PubChem CID 157486988) has the molecular formula C8H5F6IN4S2 and a molecular weight of 462.18 g/mol. Its IUPAC name is 5-iodo-4-(trifluoromethyl)-1,3-thiazol-2-amine;4-(trifluoromethyl)-1,3-thiazol-2-amine.
| Compound Name | 5-iodo-4-(trifluoromethyl)-1,3-thiazol-2-amine;4-(trifluoromethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 157486988 |
| Molecular Formula | C8H5F6IN4S2 |
| Molecular Weight | 462.18 g/mol |
| Exact Mass | 461.89 |
| IUPAC Name | 5-iodo-4-(trifluoromethyl)-1,3-thiazol-2-amine;4-(trifluoromethyl)-1,3-thiazol-2-amine |
| SMILES | Nc1nc(C(F)(F)F)c(I)s1.Nc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C4H2F3IN2S.C4H3F3N2S/c5-4(6,7)1-2(8)11-3(9)10-1;5-4(6,7)2-1-10-3(8)9-2/h(H2,9,10);1H,(H2,8,9) |
| InChIKey | BWVIVEBYHFOVNP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.18 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|