C15H20F3N3OS — CID 159597306
adamantane-1-carboxamide;4-(trifluoromethyl)-1,3-thiazol-2-amine (PubChem CID 159597306) has the molecular formula C15H20F3N3OS and a molecular weight of 347.41 g/mol. Its IUPAC name is adamantane-1-carboxamide;4-(trifluoromethyl)-1,3-thiazol-2-amine.
| Compound Name | adamantane-1-carboxamide;4-(trifluoromethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 159597306 |
| Molecular Formula | C15H20F3N3OS |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | adamantane-1-carboxamide;4-(trifluoromethyl)-1,3-thiazol-2-amine |
| SMILES | NC(=O)C12CC3CC(CC(C3)C1)C2.Nc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C11H17NO.C4H3F3N2S/c12-10(13)11-4-7-1-8(5-11)3-9(2-7)6-11;5-4(6,7)2-1-10-3(8)9-2/h7-9H,1-6H2,(H2,12,13);1H,(H2,8,9) |
| InChIKey | MLABSDNDDKGZDT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |