C26H21N3O2 — CID 157487820
2-methyl-5-[2-[(4-phenoxyphenyl)methyl]pyrimidin-4-yl]oxy-1H-indole (PubChem CID 157487820) has the molecular formula C26H21N3O2 and a molecular weight of 407.47 g/mol. Its IUPAC name is 2-methyl-5-[2-[(4-phenoxyphenyl)methyl]pyrimidin-4-yl]oxy-1H-indole.
| Compound Name | 2-methyl-5-[2-[(4-phenoxyphenyl)methyl]pyrimidin-4-yl]oxy-1H-indole |
|---|---|
| PubChem CID | 157487820 |
| Molecular Formula | C26H21N3O2 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 2-methyl-5-[2-[(4-phenoxyphenyl)methyl]pyrimidin-4-yl]oxy-1H-indole |
| SMILES | Cc1cc2cc(Oc3ccnc(Cc4ccc(Oc5ccccc5)cc4)n3)ccc2[nH]1 |
| InChI | InChI=1S/C26H21N3O2/c1-18-15-20-17-23(11-12-24(20)28-18)31-26-13-14-27-25(29-26)16-19-7-9-22(10-8-19)30-21-5-3-2-4-6-21/h2-15,17,28H,16H2,1H3 |
| InChIKey | BWXPOQLNWPVRFT-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |