C29H23N3O4 — CID 23652869
6-[2-(methoxymethyl)pyrimidin-4-yl]oxy-N-(3-phenoxyphenyl)naphthalene-1-carboxamide (PubChem CID 23652869) has the molecular formula C29H23N3O4 and a molecular weight of 477.52 g/mol. Its IUPAC name is 6-[2-(methoxymethyl)pyrimidin-4-yl]oxy-N-(3-phenoxyphenyl)naphthalene-1-carboxamide.
| Compound Name | 6-[2-(methoxymethyl)pyrimidin-4-yl]oxy-N-(3-phenoxyphenyl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 23652869 |
| Molecular Formula | C29H23N3O4 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 6-[2-(methoxymethyl)pyrimidin-4-yl]oxy-N-(3-phenoxyphenyl)naphthalene-1-carboxamide |
| SMILES | COCc1nccc(Oc2ccc3c(C(=O)Nc4cccc(Oc5ccccc5)c4)cccc3c2)n1 |
| InChI | InChI=1S/C29H23N3O4/c1-34-19-27-30-16-15-28(32-27)36-24-13-14-25-20(17-24)7-5-12-26(25)29(33)31-21-8-6-11-23(18-21)35-22-9-3-2-4-10-22/h2-18H,19H2,1H3,(H,31,33) |
| InChIKey | PJBDBJJPQNLEQV-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |