C28H22N4O4S — CID 122377977
6-[2-(3-methylsulfonylanilino)pyrimidin-4-yl]oxy-N-phenylnaphthalene-1-carboxamide (PubChem CID 122377977) has the molecular formula C28H22N4O4S and a molecular weight of 510.58 g/mol. Its IUPAC name is 6-[2-(3-methylsulfonylanilino)pyrimidin-4-yl]oxy-N-phenylnaphthalene-1-carboxamide.
| Compound Name | 6-[2-(3-methylsulfonylanilino)pyrimidin-4-yl]oxy-N-phenylnaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 122377977 |
| Molecular Formula | C28H22N4O4S |
| Molecular Weight | 510.58 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | 6-[2-(3-methylsulfonylanilino)pyrimidin-4-yl]oxy-N-phenylnaphthalene-1-carboxamide |
| SMILES | CS(=O)(=O)c1cccc(Nc2nccc(Oc3ccc4c(C(=O)Nc5ccccc5)cccc4c3)n2)c1 |
| InChI | InChI=1S/C28H22N4O4S/c1-37(34,35)23-11-6-10-21(18-23)31-28-29-16-15-26(32-28)36-22-13-14-24-19(17-22)7-5-12-25(24)27(33)30-20-8-3-2-4-9-20/h2-18H,1H3,(H,30,33)(H,29,31,32) |
| InChIKey | MNEHOCFSOJLZLO-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.58 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |