C19H17NO4S — CID 9071032
3-methoxy-N-(3-methylsulfonylphenyl)naphthalene-2-carboxamide (PubChem CID 9071032) has the molecular formula C19H17NO4S and a molecular weight of 355.42 g/mol. Its IUPAC name is 3-methoxy-N-(3-methylsulfonylphenyl)naphthalene-2-carboxamide.
| Compound Name | 3-methoxy-N-(3-methylsulfonylphenyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 9071032 |
| Molecular Formula | C19H17NO4S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 3-methoxy-N-(3-methylsulfonylphenyl)naphthalene-2-carboxamide |
| SMILES | COc1cc2ccccc2cc1C(=O)Nc1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C19H17NO4S/c1-24-18-11-14-7-4-3-6-13(14)10-17(18)19(21)20-15-8-5-9-16(12-15)25(2,22)23/h3-12H,1-2H3,(H,20,21) |
| InChIKey | GOOBCZOGNFLKBL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |