C19H19Cl2FN2O — CID 157493136
1-(2-chloroanilino)-2-(4-chloro-2-fluorophenyl)imino-4,4-dimethylpentan-3-one (PubChem CID 157493136) has the molecular formula C19H19Cl2FN2O and a molecular weight of 381.28 g/mol. Its IUPAC name is 1-(2-chloroanilino)-2-(4-chloro-2-fluorophenyl)imino-4,4-dimethylpentan-3-one.
| Compound Name | 1-(2-chloroanilino)-2-(4-chloro-2-fluorophenyl)imino-4,4-dimethylpentan-3-one |
|---|---|
| PubChem CID | 157493136 |
| Molecular Formula | C19H19Cl2FN2O |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 1-(2-chloroanilino)-2-(4-chloro-2-fluorophenyl)imino-4,4-dimethylpentan-3-one |
| SMILES | CC(C)(C)C(=O)/C(CNc1ccccc1Cl)=N/c1ccc(Cl)cc1F |
| InChI | InChI=1S/C19H19Cl2FN2O/c1-19(2,3)18(25)17(11-23-15-7-5-4-6-13(15)21)24-16-9-8-12(20)10-14(16)22/h4-10,23H,11H2,1-3H3/b24-17+ |
| InChIKey | VIZLBTXVNGRUBK-JJIBRWJFSA-N |
| XLogP | 5.93 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|