C10H14N2 — CID 157495827
3-methyl-6-prop-1-enylcyclohex-3-ene-1,2-diimine (PubChem CID 157495827) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 3-methyl-6-prop-1-enylcyclohex-3-ene-1,2-diimine.
| Compound Name | 3-methyl-6-prop-1-enylcyclohex-3-ene-1,2-diimine |
|---|---|
| PubChem CID | 157495827 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 3-methyl-6-prop-1-enylcyclohex-3-ene-1,2-diimine |
| SMILES | [H]/N=C1C(=N\[H])\C(C)=CCC\1C=CC |
| InChI | InChI=1S/C10H14N2/c1-3-4-8-6-5-7(2)9(11)10(8)12/h3-5,8,11-12H,6H2,1-2H3/b4-3?,11-9+,12-10- |
| InChIKey | GYZRAHIBLSIXFC-DTFKRFICSA-N |
| XLogP | 2.57 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|