About 3-[4-fluoro-1-(4-fluoro-3-methylphenyl)-2-propan-2-yl-5H-pyrrolo[3,4-f]indol-3-yl]propanoic acid
3-[4-fluoro-1-(4-fluoro-3-methylphenyl)-2-propan-2-yl-5H-pyrrolo[3,4-f]indol-3-yl]propanoic acid (PubChem CID 157496698) has the molecular formula C23H22F2N2O2
and a molecular weight of 396.44 g/mol. Its IUPAC name is 3-[4-fluoro-1-(4-fluoro-3-methylphenyl)-2-propan-2-yl-5H-pyrrolo[3,4-f]indol-3-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[4-fluoro-1-(4-fluoro-3-methylphenyl)-2-propan-2-yl-5H-pyrrolo[3,4-f]indol-3-yl]propanoic acid |
| PubChem CID | 157496698 |
| Molecular Formula | C23H22F2N2O2 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 3-[4-fluoro-1-(4-fluoro-3-methylphenyl)-2-propan-2-yl-5H-pyrrolo[3,4-f]indol-3-yl]propanoic acid |
| SMILES | Cc1cc(-n2c(C(C)C)c(CCC(=O)O)c3c(F)c4c(cc32)C=NC4)ccc1F |
| InChI | InChI=1S/C23H22F2N2O2/c1-12(2)23-16(5-7-20(28)29)21-19(9-14-10-26-11-17(14)22(21)25)27(23)15-4-6-18(24)13(3)8-15/h4,6,8-10,12H,5,7,11H2,1-3H3,(H,28,29) |
| InChIKey | WOMXUNVFSVTMSE-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[4-fluoro-1-(4-fluoro-3-methylphenyl)-2-propan-2-yl-5H-pyrrolo[3,4-f]indol-3-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-fluoro-1-(4-fluoro-3-methylphenyl)-2-propan-2-yl-5H-pyrrolo[3,4-f]indol-3-yl]propanoic acid?
The IUPAC name of 3-[4-fluoro-1-(4-fluoro-3-methylphenyl)-2-propan-2-yl-5H-pyrrolo[3,4-f]indol-3-yl]propanoic acid (CID 157496698) is 3-[4-fluoro-1-(4-fluoro-3-methylphenyl)-2-propan-2-yl-5H-pyrrolo[3,4-f]indol-3-yl]propanoic acid.
What is the SMILES notation for 3-[4-fluoro-1-(4-fluoro-3-methylphenyl)-2-propan-2-yl-5H-pyrrolo[3,4-f]indol-3-yl]propanoic acid?
The canonical SMILES for 3-[4-fluoro-1-(4-fluoro-3-methylphenyl)-2-propan-2-yl-5H-pyrrolo[3,4-f]indol-3-yl]propanoic acid is Cc1cc(-n2c(C(C)C)c(CCC(=O)O)c3c(F)c4c(cc32)C=NC4)ccc1F.
What is the InChIKey of 3-[4-fluoro-1-(4-fluoro-3-methylphenyl)-2-propan-2-yl-5H-pyrrolo[3,4-f]indol-3-yl]propanoic acid?
The InChIKey is WOMXUNVFSVTMSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22F2N2O2/c1-12(2)23-16(5-7-20(28)29)21-19(9-14-10-26-11-17(14)22(21)25)27(23)15-4-6-18(24)13(3)8-15/h4,6,8-10,12H,5,7,11H2,1-3H3,(H,28,29).
What are the key properties of 3-[4-fluoro-1-(4-fluoro-3-methylphenyl)-2-propan-2-yl-5H-pyrrolo[3,4-f]indol-3-yl]propanoic acid?
3-[4-fluoro-1-(4-fluoro-3-methylphenyl)-2-propan-2-yl-5H-pyrrolo[3,4-f]indol-3-yl]propanoic acid has a molecular weight of 396.44 g/mol, XLogP of 5.29, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-fluoro-1-(4-fluoro-3-methylphenyl)-2-propan-2-yl-5H-pyrrolo[3,4-f]indol-3-yl]propanoic acid is sourced from PubChem (CID 157496698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).