About 6-methylquinoxaline;quinoxaline-6-carbaldehyde
6-methylquinoxaline;quinoxaline-6-carbaldehyde (PubChem CID 157496961) has the molecular formula C18H14N4O
and a molecular weight of 302.34 g/mol. Its IUPAC name is 6-methylquinoxaline;quinoxaline-6-carbaldehyde.
Molecular Properties
| Compound Name | 6-methylquinoxaline;quinoxaline-6-carbaldehyde |
| PubChem CID | 157496961 |
| Molecular Formula | C18H14N4O |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 6-methylquinoxaline;quinoxaline-6-carbaldehyde |
| SMILES | Cc1ccc2nccnc2c1.O=Cc1ccc2nccnc2c1 |
| InChI | InChI=1S/C9H6N2O.C9H8N2/c12-6-7-1-2-8-9(5-7)11-4-3-10-8;1-7-2-3-8-9(6-7)11-5-4-10-8/h1-6H;2-6H,1H3 |
| InChIKey | BXYIAESXOOXEKT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 68.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-methylquinoxaline;quinoxaline-6-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylquinoxaline;quinoxaline-6-carbaldehyde?
The IUPAC name of 6-methylquinoxaline;quinoxaline-6-carbaldehyde (CID 157496961) is 6-methylquinoxaline;quinoxaline-6-carbaldehyde.
What is the SMILES notation for 6-methylquinoxaline;quinoxaline-6-carbaldehyde?
The canonical SMILES for 6-methylquinoxaline;quinoxaline-6-carbaldehyde is Cc1ccc2nccnc2c1.O=Cc1ccc2nccnc2c1.
What is the InChIKey of 6-methylquinoxaline;quinoxaline-6-carbaldehyde?
The InChIKey is BXYIAESXOOXEKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O.C9H8N2/c12-6-7-1-2-8-9(5-7)11-4-3-10-8;1-7-2-3-8-9(6-7)11-5-4-10-8/h1-6H;2-6H,1H3.
What are the key properties of 6-methylquinoxaline;quinoxaline-6-carbaldehyde?
6-methylquinoxaline;quinoxaline-6-carbaldehyde has a molecular weight of 302.34 g/mol, XLogP of 3.38, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylquinoxaline;quinoxaline-6-carbaldehyde is sourced from PubChem (CID 157496961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).