C12H10Cl3N — CID 15749820
2,4-dichloro-3-(2-chloroethyl)-8-methylquinoline (PubChem CID 15749820) has the molecular formula C12H10Cl3N and a molecular weight of 274.58 g/mol. Its IUPAC name is 2,4-dichloro-3-(2-chloroethyl)-8-methylquinoline.
| Compound Name | 2,4-dichloro-3-(2-chloroethyl)-8-methylquinoline |
|---|---|
| PubChem CID | 15749820 |
| Molecular Formula | C12H10Cl3N |
| Molecular Weight | 274.58 g/mol |
| Exact Mass | 272.99 |
| IUPAC Name | 2,4-dichloro-3-(2-chloroethyl)-8-methylquinoline |
| SMILES | Cc1cccc2c(Cl)c(CCCl)c(Cl)nc12 |
| InChI | InChI=1S/C12H10Cl3N/c1-7-3-2-4-8-10(14)9(5-6-13)12(15)16-11(7)8/h2-4H,5-6H2,1H3 |
| InChIKey | HJGJMHPWAIAVMN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.58 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|