C13H19N3 — CID 15750214
(3R,4R)-3-(3-propylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane (PubChem CID 15750214) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is (3R,4R)-3-(3-propylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane.
| Compound Name | (3R,4R)-3-(3-propylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 15750214 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | (3R,4R)-3-(3-propylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane |
| SMILES | CCCc1nccnc1[C@H]1CN2CC[C@H]1C2 |
| InChI | InChI=1S/C13H19N3/c1-2-3-12-13(15-6-5-14-12)11-9-16-7-4-10(11)8-16/h5-6,10-11H,2-4,7-9H2,1H3/t10-,11-/m0/s1 |
| InChIKey | BAWYEFKZQWTWQQ-QWRGUYRKSA-N |
| XLogP | 1.85 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |