C29H34N6O8 — CID 15755326
(2R)-2-[[(2S)-5-amino-2-[[(2S)-5-amino-5-oxo-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-5-oxopentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 15755326) has the molecular formula C29H34N6O8 and a molecular weight of 594.63 g/mol. Its IUPAC name is (2R)-2-[[(2S)-5-amino-2-[[(2S)-5-amino-5-oxo-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-5-oxopentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | (2R)-2-[[(2S)-5-amino-2-[[(2S)-5-amino-5-oxo-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-5-oxopentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 15755326 |
| Molecular Formula | C29H34N6O8 |
| Molecular Weight | 594.63 g/mol |
| Exact Mass | 594.24 |
| IUPAC Name | (2R)-2-[[(2S)-5-amino-2-[[(2S)-5-amino-5-oxo-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-5-oxopentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | NC(=O)CC[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C29H34N6O8/c30-24(36)12-10-21(26(38)34-23(28(40)41)14-18-15-32-20-9-5-4-8-19(18)20)33-27(39)22(11-13-25(31)37)35-29(42)43-16-17-6-2-1-3-7-17/h1-9,15,21-23,32H,10-14,16H2,(H2,30,36)(H2,31,37)(H,33,39)(H,34,38)(H,35,42)(H,40,41)/t21-,22-,23+/m0/s1 |
| InChIKey | JCOGRWPRTDPJTH-RJGXRXQPSA-N |
| XLogP | 0.59 |
| TPSA | 235.80 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.63 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |