C38H37N3O7 — CID 25186248
dibenzyl (2R)-2-[[(2S)-3-(1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanedioate (PubChem CID 25186248) has the molecular formula C38H37N3O7 and a molecular weight of 647.73 g/mol. Its IUPAC name is dibenzyl (2R)-2-[[(2S)-3-(1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanedioate.
| Compound Name | dibenzyl (2R)-2-[[(2S)-3-(1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 25186248 |
| Molecular Formula | C38H37N3O7 |
| Molecular Weight | 647.73 g/mol |
| Exact Mass | 647.26 |
| IUPAC Name | dibenzyl (2R)-2-[[(2S)-3-(1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanedioate |
| SMILES | O=C(CC[C@@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C38H37N3O7/c42-35(46-24-27-12-4-1-5-13-27)21-20-33(37(44)47-25-28-14-6-2-7-15-28)40-36(43)34(22-30-23-39-32-19-11-10-18-31(30)32)41-38(45)48-26-29-16-8-3-9-17-29/h1-19,23,33-34,39H,20-22,24-26H2,(H,40,43)(H,41,45)/t33-,34+/m1/s1 |
| InChIKey | MJCXZBKLTFSYAI-NOCHOARKSA-N |
| XLogP | 5.76 |
| TPSA | 135.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.73 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|