C17H22ClN2O2+ — CID 15758749
[(5S,7R)-1-ethyl-3-aza-1-azoniatricyclo[3.3.1.13,7]decan-6-yl] 4-chlorobenzoate (PubChem CID 15758749) has the molecular formula C17H22ClN2O2+ and a molecular weight of 321.83 g/mol. Its IUPAC name is [(5S,7R)-1-ethyl-3-aza-1-azoniatricyclo[3.3.1.13,7]decan-6-yl] 4-chlorobenzoate.
| Compound Name | [(5S,7R)-1-ethyl-3-aza-1-azoniatricyclo[3.3.1.13,7]decan-6-yl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 15758749 |
| Molecular Formula | C17H22ClN2O2+ |
| Molecular Weight | 321.83 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | [(5S,7R)-1-ethyl-3-aza-1-azoniatricyclo[3.3.1.13,7]decan-6-yl] 4-chlorobenzoate |
| SMILES | CC[N+]12C[C@H]3CN(C[C@@H](C1)C3OC(=O)c1ccc(Cl)cc1)C2 |
| InChI | InChI=1S/C17H22ClN2O2/c1-2-20-9-13-7-19(11-20)8-14(10-20)16(13)22-17(21)12-3-5-15(18)6-4-12/h3-6,13-14,16H,2,7-11H2,1H3/q+1/t13-,14+,16?,20? |
| InChIKey | DMVAEAFAZRXTPX-IUXSAEICSA-N |
| XLogP | 2.23 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.83 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|