C34H33NO12 — CID 15759127
hexamethyl (1R,3S,6R,8R,9R,10R)-13-(4-methylphenyl)-13-azapentacyclo[6.5.2.13,6.01,10.02,7]hexadeca-2(7),4,11,14-tetraene-9,10,11,12,14,15-hexacarboxylate (PubChem CID 15759127) has the molecular formula C34H33NO12 and a molecular weight of 647.63 g/mol. Its IUPAC name is hexamethyl (1R,3S,6R,8R,9R,10R)-13-(4-methylphenyl)-13-azapentacyclo[6.5.2.13,6.01,10.02,7]hexadeca-2(7),4,11,14-tetraene-9,10,11,12,14,15-hexacarboxylate.
| Compound Name | hexamethyl (1R,3S,6R,8R,9R,10R)-13-(4-methylphenyl)-13-azapentacyclo[6.5.2.13,6.01,10.02,7]hexadeca-2(7),4,11,14-tetraene-9,10,11,12,14,15-hexacarboxylate |
|---|---|
| PubChem CID | 15759127 |
| Molecular Formula | C34H33NO12 |
| Molecular Weight | 647.63 g/mol |
| Exact Mass | 647.20 |
| IUPAC Name | hexamethyl (1R,3S,6R,8R,9R,10R)-13-(4-methylphenyl)-13-azapentacyclo[6.5.2.13,6.01,10.02,7]hexadeca-2(7),4,11,14-tetraene-9,10,11,12,14,15-hexacarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@]23C4=C([C@H]1[C@@H](C(=O)OC)[C@@]2(C(=O)OC)C(C(=O)OC)=C(C(=O)OC)N3c1ccc(C)cc1)[C@H]1C=C[C@@H]4C1 |
| InChI | InChI=1S/C34H33NO12/c1-15-8-12-18(13-9-15)35-26(31(40)46-6)25(30(39)45-5)33(32(41)47-7)23(28(37)43-3)20-19-16-10-11-17(14-16)22(19)34(33,35)24(29(38)44-4)21(20)27(36)42-2/h8-13,16-17,20,23H,14H2,1-7H3/t16-,17+,20+,23-,33-,34+/m0/s1 |
| InChIKey | FXVRARFZGCLJAM-OPAPLFDGSA-N |
| XLogP | 1.89 |
| TPSA | 161.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.63 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|