C26H25NO8 — CID 53473534
tetramethyl 1-(4-methylphenyl)-4-phenyl-4H-pyridine-2,3,5,6-tetracarboxylate (PubChem CID 53473534) has the molecular formula C26H25NO8 and a molecular weight of 479.49 g/mol. Its IUPAC name is tetramethyl 1-(4-methylphenyl)-4-phenyl-4H-pyridine-2,3,5,6-tetracarboxylate.
| Compound Name | tetramethyl 1-(4-methylphenyl)-4-phenyl-4H-pyridine-2,3,5,6-tetracarboxylate |
|---|---|
| PubChem CID | 53473534 |
| Molecular Formula | C26H25NO8 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | tetramethyl 1-(4-methylphenyl)-4-phenyl-4H-pyridine-2,3,5,6-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(C)cc2)C(C(=O)OC)=C(C(=O)OC)C1c1ccccc1 |
| InChI | InChI=1S/C26H25NO8/c1-15-11-13-17(14-12-15)27-21(25(30)34-4)19(23(28)32-2)18(16-9-7-6-8-10-16)20(24(29)33-3)22(27)26(31)35-5/h6-14,18H,1-5H3 |
| InChIKey | IARXPLBUHJCOTL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|