C18H21NO4 — CID 15765193
[(1S,15R,16S)-4-hydroxy-5-methoxy-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-2,4,6,12-tetraen-15-yl] acetate (PubChem CID 15765193) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is [(1S,15R,16S)-4-hydroxy-5-methoxy-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-2,4,6,12-tetraen-15-yl] acetate.
| Compound Name | [(1S,15R,16S)-4-hydroxy-5-methoxy-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-2,4,6,12-tetraen-15-yl] acetate |
|---|---|
| PubChem CID | 15765193 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | [(1S,15R,16S)-4-hydroxy-5-methoxy-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-2,4,6,12-tetraen-15-yl] acetate |
| SMILES | COc1cc2c(cc1O)[C@H]1[C@H]3C(=CC[C@H]1OC(C)=O)CCN3C2 |
| InChI | InChI=1S/C18H21NO4/c1-10(20)23-15-4-3-11-5-6-19-9-12-7-16(22-2)14(21)8-13(12)17(15)18(11)19/h3,7-8,15,17-18,21H,4-6,9H2,1-2H3/t15-,17-,18-/m1/s1 |
| InChIKey | ICDPFHWASZCJQE-KBAYOESNSA-N |
| XLogP | 2.33 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|