C18H23NO4 — CID 162968523
(1R,14R,15S,16S)-4,5,15-trimethoxy-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-2,4,6,12-tetraen-14-ol (PubChem CID 162968523) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is (1R,14R,15S,16S)-4,5,15-trimethoxy-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-2,4,6,12-tetraen-14-ol.
| Compound Name | (1R,14R,15S,16S)-4,5,15-trimethoxy-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-2,4,6,12-tetraen-14-ol |
|---|---|
| PubChem CID | 162968523 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | (1R,14R,15S,16S)-4,5,15-trimethoxy-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-2,4,6,12-tetraen-14-ol |
| SMILES | COc1cc2c(cc1OC)[C@H]1[C@H](OC)[C@H](O)C=C3CCN(C2)[C@H]31 |
| InChI | InChI=1S/C18H23NO4/c1-21-14-7-11-9-19-5-4-10-6-13(20)18(23-3)16(17(10)19)12(11)8-15(14)22-2/h6-8,13,16-18,20H,4-5,9H2,1-3H3/t13-,16-,17-,18-/m1/s1 |
| InChIKey | XGZRNPBCCBSDQB-BNEJOLLZSA-N |
| XLogP | 1.69 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|