C18H23NO2 — CID 15765755
3,5-bis[[(2R)-3,3-dimethyloxiran-2-yl]methyl]-1H-indole (PubChem CID 15765755) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 3,5-bis[[(2R)-3,3-dimethyloxiran-2-yl]methyl]-1H-indole.
| Compound Name | 3,5-bis[[(2R)-3,3-dimethyloxiran-2-yl]methyl]-1H-indole |
|---|---|
| PubChem CID | 15765755 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 3,5-bis[[(2R)-3,3-dimethyloxiran-2-yl]methyl]-1H-indole |
| SMILES | CC1(C)O[C@@H]1Cc1ccc2[nH]cc(C[C@H]3OC3(C)C)c2c1 |
| InChI | InChI=1S/C18H23NO2/c1-17(2)15(20-17)8-11-5-6-14-13(7-11)12(10-19-14)9-16-18(3,4)21-16/h5-7,10,15-16,19H,8-9H2,1-4H3/t15-,16-/m1/s1 |
| InChIKey | BDCXIQBZUKFYBG-HZPDHXFCSA-N |
| XLogP | 3.61 |
| TPSA | 40.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|