C38H40O8P2 — CID 15789016
[4-bis(2,6-dimethylphenoxy)phosphoryloxyphenyl] bis(2,6-dimethylphenyl) phosphate (PubChem CID 15789016) has the molecular formula C38H40O8P2 and a molecular weight of 686.68 g/mol. Its IUPAC name is [4-bis(2,6-dimethylphenoxy)phosphoryloxyphenyl] bis(2,6-dimethylphenyl) phosphate.
| Compound Name | [4-bis(2,6-dimethylphenoxy)phosphoryloxyphenyl] bis(2,6-dimethylphenyl) phosphate |
|---|---|
| PubChem CID | 15789016 |
| Molecular Formula | C38H40O8P2 |
| Molecular Weight | 686.68 g/mol |
| Exact Mass | 686.22 |
| IUPAC Name | [4-bis(2,6-dimethylphenoxy)phosphoryloxyphenyl] bis(2,6-dimethylphenyl) phosphate |
| SMILES | Cc1cccc(C)c1OP(=O)(Oc1ccc(OP(=O)(Oc2c(C)cccc2C)Oc2c(C)cccc2C)cc1)Oc1c(C)cccc1C |
| InChI | InChI=1S/C38H40O8P2/c1-25-13-9-14-26(2)35(25)43-47(39,44-36-27(3)15-10-16-28(36)4)41-33-21-23-34(24-22-33)42-48(40,45-37-29(5)17-11-18-30(37)6)46-38-31(7)19-12-20-32(38)8/h9-24H,1-8H3 |
| InChIKey | BDKLOPPYTKDXOZ-UHFFFAOYSA-N |
| XLogP | 11.44 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.68 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|