C14H30N6O4 — CID 15795404
3,11-dimethyl-3,11-dinitro-1,5,9,13-tetrazacyclohexadecane (PubChem CID 15795404) has the molecular formula C14H30N6O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 3,11-dimethyl-3,11-dinitro-1,5,9,13-tetrazacyclohexadecane.
| Compound Name | 3,11-dimethyl-3,11-dinitro-1,5,9,13-tetrazacyclohexadecane |
|---|---|
| PubChem CID | 15795404 |
| Molecular Formula | C14H30N6O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 3,11-dimethyl-3,11-dinitro-1,5,9,13-tetrazacyclohexadecane |
| SMILES | CC1([N+](=O)[O-])CNCCCNCC(C)([N+](=O)[O-])CNCCCNC1 |
| InChI | InChI=1S/C14H30N6O4/c1-13(19(21)22)9-15-5-3-7-17-11-14(2,20(23)24)12-18-8-4-6-16-10-13/h15-18H,3-12H2,1-2H3 |
| InChIKey | JNADLHJBMLYBSV-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 134.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|