C8H16N2S — CID 143253901
3,3-dimethyl-1,5-diazocane-2-thione (PubChem CID 143253901) has the molecular formula C8H16N2S and a molecular weight of 172.30 g/mol. Its IUPAC name is 3,3-dimethyl-1,5-diazocane-2-thione.
| Compound Name | 3,3-dimethyl-1,5-diazocane-2-thione |
|---|---|
| PubChem CID | 143253901 |
| Molecular Formula | C8H16N2S |
| Molecular Weight | 172.30 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 3,3-dimethyl-1,5-diazocane-2-thione |
| SMILES | CC1(C)CNCCCNC1=S |
| InChI | InChI=1S/C8H16N2S/c1-8(2)6-9-4-3-5-10-7(8)11/h9H,3-6H2,1-2H3,(H,10,11) |
| InChIKey | WWCLXMVMEOKIIU-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|