About anthracen-9-ylmethanol;pyren-2-ylmethanol
anthracen-9-ylmethanol;pyren-2-ylmethanol (PubChem CID 158001139) has the molecular formula C32H24O2
and a molecular weight of 440.54 g/mol. Its IUPAC name is anthracen-9-ylmethanol;pyren-2-ylmethanol.
Molecular Properties
| Compound Name | anthracen-9-ylmethanol;pyren-2-ylmethanol |
| PubChem CID | 158001139 |
| Molecular Formula | C32H24O2 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | anthracen-9-ylmethanol;pyren-2-ylmethanol |
| SMILES | OCc1c2ccccc2cc2ccccc12.OCc1cc2ccc3cccc4ccc(c1)c2c34 |
| InChI | InChI=1S/C17H12O.C15H12O/c18-10-11-8-14-6-4-12-2-1-3-13-5-7-15(9-11)17(14)16(12)13;16-10-15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)15/h1-9,18H,10H2;1-9,16H,10H2 |
| InChIKey | FDTDCJCYJUTRKY-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze anthracen-9-ylmethanol;pyren-2-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracen-9-ylmethanol;pyren-2-ylmethanol?
The IUPAC name of anthracen-9-ylmethanol;pyren-2-ylmethanol (CID 158001139) is anthracen-9-ylmethanol;pyren-2-ylmethanol.
What is the SMILES notation for anthracen-9-ylmethanol;pyren-2-ylmethanol?
The canonical SMILES for anthracen-9-ylmethanol;pyren-2-ylmethanol is OCc1c2ccccc2cc2ccccc12.OCc1cc2ccc3cccc4ccc(c1)c2c34.
What is the InChIKey of anthracen-9-ylmethanol;pyren-2-ylmethanol?
The InChIKey is FDTDCJCYJUTRKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12O.C15H12O/c18-10-11-8-14-6-4-12-2-1-3-13-5-7-15(9-11)17(14)16(12)13;16-10-15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)15/h1-9,18H,10H2;1-9,16H,10H2.
What are the key properties of anthracen-9-ylmethanol;pyren-2-ylmethanol?
anthracen-9-ylmethanol;pyren-2-ylmethanol has a molecular weight of 440.54 g/mol, XLogP of 7.56, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for anthracen-9-ylmethanol;pyren-2-ylmethanol is sourced from PubChem (CID 158001139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).