C32H23F3N4O2 — CID 158001514
6-amino-4-[4-[3-[2-oxo-3-[3-(trifluoromethyl)phenyl]propyl]phenoxy]anilino]quinoline-3-carbonitrile (PubChem CID 158001514) has the molecular formula C32H23F3N4O2 and a molecular weight of 552.56 g/mol. Its IUPAC name is 6-amino-4-[4-[3-[2-oxo-3-[3-(trifluoromethyl)phenyl]propyl]phenoxy]anilino]quinoline-3-carbonitrile.
| Compound Name | 6-amino-4-[4-[3-[2-oxo-3-[3-(trifluoromethyl)phenyl]propyl]phenoxy]anilino]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 158001514 |
| Molecular Formula | C32H23F3N4O2 |
| Molecular Weight | 552.56 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | 6-amino-4-[4-[3-[2-oxo-3-[3-(trifluoromethyl)phenyl]propyl]phenoxy]anilino]quinoline-3-carbonitrile |
| SMILES | N#Cc1cnc2ccc(N)cc2c1Nc1ccc(Oc2cccc(CC(=O)Cc3cccc(C(F)(F)F)c3)c2)cc1 |
| InChI | InChI=1S/C32H23F3N4O2/c33-32(34,35)23-5-1-3-20(13-23)14-26(40)15-21-4-2-6-28(16-21)41-27-10-8-25(9-11-27)39-31-22(18-36)19-38-30-12-7-24(37)17-29(30)31/h1-13,16-17,19H,14-15,37H2,(H,38,39) |
| InChIKey | AAJOMLXFEDFTQW-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.56 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|