C17H16N2O3 — CID 158002363
6,7-dimethoxy-1-methyl-4-phenylquinazolin-2-one (PubChem CID 158002363) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is 6,7-dimethoxy-1-methyl-4-phenylquinazolin-2-one.
| Compound Name | 6,7-dimethoxy-1-methyl-4-phenylquinazolin-2-one |
|---|---|
| PubChem CID | 158002363 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 6,7-dimethoxy-1-methyl-4-phenylquinazolin-2-one |
| SMILES | COc1cc2c(-c3ccccc3)nc(=O)n(C)c2cc1OC |
| InChI | InChI=1S/C17H16N2O3/c1-19-13-10-15(22-3)14(21-2)9-12(13)16(18-17(19)20)11-7-5-4-6-8-11/h4-10H,1-3H3 |
| InChIKey | FDWQSSAKIXWXHL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |