C28H26F2N2O3Se — CID 158003196
6-(2,6-dimethylphenyl)-3-fluoro-2-methylpyridine;6-(2,6-dimethylphenyl)-3-fluoropyridine-2-carbaldehyde;selenium dioxide (PubChem CID 158003196) has the molecular formula C28H26F2N2O3Se and a molecular weight of 555.48 g/mol. Its IUPAC name is 6-(2,6-dimethylphenyl)-3-fluoro-2-methylpyridine;6-(2,6-dimethylphenyl)-3-fluoropyridine-2-carbaldehyde;selenium dioxide.
| Compound Name | 6-(2,6-dimethylphenyl)-3-fluoro-2-methylpyridine;6-(2,6-dimethylphenyl)-3-fluoropyridine-2-carbaldehyde;selenium dioxide |
|---|---|
| PubChem CID | 158003196 |
| Molecular Formula | C28H26F2N2O3Se |
| Molecular Weight | 555.48 g/mol |
| Exact Mass | 556.11 |
| IUPAC Name | 6-(2,6-dimethylphenyl)-3-fluoro-2-methylpyridine;6-(2,6-dimethylphenyl)-3-fluoropyridine-2-carbaldehyde;selenium dioxide |
| SMILES | Cc1cccc(C)c1-c1ccc(F)c(C)n1.Cc1cccc(C)c1-c1ccc(F)c(C=O)n1.O=[Se]=O |
| InChI | InChI=1S/C14H12FNO.C14H14FN.O2Se/c1-9-4-3-5-10(2)14(9)12-7-6-11(15)13(8-17)16-12;1-9-5-4-6-10(2)14(9)13-8-7-12(15)11(3)16-13;1-3-2/h3-8H,1-2H3;4-8H,1-3H3; |
| InChIKey | FDZBKXXJBAEXLN-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 76.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.48 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|