C37H38N4O6 — CID 158004081
tert-butyl N-[[3-[(4-benzoylbenzoyl)amino]-4-methylanilino]-[(3-methoxy-4,5-dimethylbenzoyl)amino]methylidene]carbamate (PubChem CID 158004081) has the molecular formula C37H38N4O6 and a molecular weight of 634.73 g/mol. Its IUPAC name is tert-butyl N-[[3-[(4-benzoylbenzoyl)amino]-4-methylanilino]-[(3-methoxy-4,5-dimethylbenzoyl)amino]methylidene]carbamate.
| Compound Name | tert-butyl N-[[3-[(4-benzoylbenzoyl)amino]-4-methylanilino]-[(3-methoxy-4,5-dimethylbenzoyl)amino]methylidene]carbamate |
|---|---|
| PubChem CID | 158004081 |
| Molecular Formula | C37H38N4O6 |
| Molecular Weight | 634.73 g/mol |
| Exact Mass | 634.28 |
| IUPAC Name | tert-butyl N-[[3-[(4-benzoylbenzoyl)amino]-4-methylanilino]-[(3-methoxy-4,5-dimethylbenzoyl)amino]methylidene]carbamate |
| SMILES | COc1cc(C(=O)NC(=NC(=O)OC(C)(C)C)Nc2ccc(C)c(NC(=O)c3ccc(C(=O)c4ccccc4)cc3)c2)cc(C)c1C |
| InChI | InChI=1S/C37H38N4O6/c1-22-13-18-29(21-30(22)39-33(43)27-16-14-26(15-17-27)32(42)25-11-9-8-10-12-25)38-35(41-36(45)47-37(4,5)6)40-34(44)28-19-23(2)24(3)31(20-28)46-7/h8-21H,1-7H3,(H,39,43)(H2,38,40,41,44,45) |
| InChIKey | FEBPLDCFFSTLEX-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 135.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.73 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|