C39H42N4O7 — CID 137099681
tert-butyl N-[N'-[4-methyl-3-[[4-(3-phenylprop-2-enyl)benzoyl]amino]phenyl]-N-(3,4,5-trimethoxybenzoyl)carbamimidoyl]carbamate (PubChem CID 137099681) has the molecular formula C39H42N4O7 and a molecular weight of 678.79 g/mol. Its IUPAC name is tert-butyl N-[N'-[4-methyl-3-[[4-(3-phenylprop-2-enyl)benzoyl]amino]phenyl]-N-(3,4,5-trimethoxybenzoyl)carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N'-[4-methyl-3-[[4-(3-phenylprop-2-enyl)benzoyl]amino]phenyl]-N-(3,4,5-trimethoxybenzoyl)carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 137099681 |
| Molecular Formula | C39H42N4O7 |
| Molecular Weight | 678.79 g/mol |
| Exact Mass | 678.31 |
| IUPAC Name | tert-butyl N-[N'-[4-methyl-3-[[4-(3-phenylprop-2-enyl)benzoyl]amino]phenyl]-N-(3,4,5-trimethoxybenzoyl)carbamimidoyl]carbamate |
| SMILES | COc1cc(C(=O)N/C(=N/c2ccc(C)c(NC(=O)c3ccc(CC=Cc4ccccc4)cc3)c2)NC(=O)OC(C)(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C39H42N4O7/c1-25-16-21-30(24-31(25)41-35(44)28-19-17-27(18-20-28)15-11-14-26-12-9-8-10-13-26)40-37(43-38(46)50-39(2,3)4)42-36(45)29-22-32(47-5)34(49-7)33(23-29)48-6/h8-14,16-24H,15H2,1-7H3,(H,41,44)(H2,40,42,43,45,46) |
| InChIKey | YBCAJKPTIFZKGN-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.79 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|