C32H33ClN4O6 — CID 136510943
3,4,5-trimethoxy-N-[N'-[4-methyl-3-[(4-phenylmethoxybenzoyl)amino]phenyl]carbamimidoyl]benzamide;hydrochloride (PubChem CID 136510943) has the molecular formula C32H33ClN4O6 and a molecular weight of 605.09 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[N'-[4-methyl-3-[(4-phenylmethoxybenzoyl)amino]phenyl]carbamimidoyl]benzamide;hydrochloride.
| Compound Name | 3,4,5-trimethoxy-N-[N'-[4-methyl-3-[(4-phenylmethoxybenzoyl)amino]phenyl]carbamimidoyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 136510943 |
| Molecular Formula | C32H33ClN4O6 |
| Molecular Weight | 605.09 g/mol |
| Exact Mass | 604.21 |
| IUPAC Name | 3,4,5-trimethoxy-N-[N'-[4-methyl-3-[(4-phenylmethoxybenzoyl)amino]phenyl]carbamimidoyl]benzamide;hydrochloride |
| SMILES | COc1cc(C(=O)N/C(N)=N/c2ccc(C)c(NC(=O)c3ccc(OCc4ccccc4)cc3)c2)cc(OC)c1OC.Cl |
| InChI | InChI=1S/C32H32N4O6.ClH/c1-20-10-13-24(34-32(33)36-31(38)23-16-27(39-2)29(41-4)28(17-23)40-3)18-26(20)35-30(37)22-11-14-25(15-12-22)42-19-21-8-6-5-7-9-21;/h5-18H,19H2,1-4H3,(H,35,37)(H3,33,34,36,38);1H |
| InChIKey | VBTUEERWDXKKAP-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 133.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.09 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|