C23H22N2O — CID 89462725
N-(5-amino-2-methylphenyl)-4-[(E)-3-phenylprop-2-enyl]benzamide (PubChem CID 89462725) has the molecular formula C23H22N2O and a molecular weight of 342.44 g/mol. Its IUPAC name is N-(5-amino-2-methylphenyl)-4-[(E)-3-phenylprop-2-enyl]benzamide.
| Compound Name | N-(5-amino-2-methylphenyl)-4-[(E)-3-phenylprop-2-enyl]benzamide |
|---|---|
| PubChem CID | 89462725 |
| Molecular Formula | C23H22N2O |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | N-(5-amino-2-methylphenyl)-4-[(E)-3-phenylprop-2-enyl]benzamide |
| SMILES | Cc1ccc(N)cc1NC(=O)c1ccc(C/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C23H22N2O/c1-17-10-15-21(24)16-22(17)25-23(26)20-13-11-19(12-14-20)9-5-8-18-6-3-2-4-7-18/h2-8,10-16H,9,24H2,1H3,(H,25,26)/b8-5+ |
| InChIKey | UBGMNDOKXUBUBP-VMPITWQZSA-N |
| XLogP | 5.09 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|