C38H42N4O7 — CID 140650192
[N-tert-butyl-4-methyl-3-[[4-(2-phenylethyl)benzoyl]amino]anilino] N-[[(3,4,5-trimethoxybenzoyl)amino]methylidene]carbamate (PubChem CID 140650192) has the molecular formula C38H42N4O7 and a molecular weight of 666.78 g/mol. Its IUPAC name is [N-tert-butyl-4-methyl-3-[[4-(2-phenylethyl)benzoyl]amino]anilino] N-[[(3,4,5-trimethoxybenzoyl)amino]methylidene]carbamate.
| Compound Name | [N-tert-butyl-4-methyl-3-[[4-(2-phenylethyl)benzoyl]amino]anilino] N-[[(3,4,5-trimethoxybenzoyl)amino]methylidene]carbamate |
|---|---|
| PubChem CID | 140650192 |
| Molecular Formula | C38H42N4O7 |
| Molecular Weight | 666.78 g/mol |
| Exact Mass | 666.31 |
| IUPAC Name | [N-tert-butyl-4-methyl-3-[[4-(2-phenylethyl)benzoyl]amino]anilino] N-[[(3,4,5-trimethoxybenzoyl)amino]methylidene]carbamate |
| SMILES | COc1cc(C(=O)NC=NC(=O)ON(c2ccc(C)c(NC(=O)c3ccc(CCc4ccccc4)cc3)c2)C(C)(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C38H42N4O7/c1-25-13-20-30(23-31(25)41-36(44)28-18-16-27(17-19-28)15-14-26-11-9-8-10-12-26)42(38(2,3)4)49-37(45)40-24-39-35(43)29-21-32(46-5)34(48-7)33(22-29)47-6/h8-13,16-24H,14-15H2,1-7H3,(H,41,44)(H,39,40,43,45) |
| InChIKey | UCXPIKWARUNAGP-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 127.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.78 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|