C23H28N4O2 — CID 158007561
5-[2-[4-(4-(111C)methylpiperazin-1-yl)-2-piperidin-1-ylphenyl]acetyl]furan-2-carbonitrile (PubChem CID 158007561) has the molecular formula C23H28N4O2 and a molecular weight of 391.50 g/mol. Its IUPAC name is 5-[2-[4-(4-(111C)methylpiperazin-1-yl)-2-piperidin-1-ylphenyl]acetyl]furan-2-carbonitrile.
| Compound Name | 5-[2-[4-(4-(111C)methylpiperazin-1-yl)-2-piperidin-1-ylphenyl]acetyl]furan-2-carbonitrile |
|---|---|
| PubChem CID | 158007561 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 5-[2-[4-(4-(111C)methylpiperazin-1-yl)-2-piperidin-1-ylphenyl]acetyl]furan-2-carbonitrile |
| SMILES | [11CH3]N1CCN(c2ccc(CC(=O)c3ccc(C#N)o3)c(N3CCCCC3)c2)CC1 |
| InChI | InChI=1S/C23H28N4O2/c1-25-11-13-26(14-12-25)19-6-5-18(21(16-19)27-9-3-2-4-10-27)15-22(28)23-8-7-20(17-24)29-23/h5-8,16H,2-4,9-15H2,1H3/i1-1 |
| InChIKey | FEMCCHJPTALTMR-BJUDXGSMSA-N |
| XLogP | 3.32 |
| TPSA | 63.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |