About sodium;sulfuric acid;periodate
sodium;sulfuric acid;periodate (PubChem CID 158009988) has the molecular formula H2INaO8S
and a molecular weight of 311.97 g/mol. Its IUPAC name is sodium;sulfuric acid;periodate.
Molecular Properties
| Compound Name | sodium;sulfuric acid;periodate |
| PubChem CID | 158009988 |
| Molecular Formula | H2INaO8S |
| Molecular Weight | 311.97 g/mol |
| Exact Mass | 311.84 |
| IUPAC Name | sodium;sulfuric acid;periodate |
| SMILES | O=S(=O)(O)O.[Na+].[O-][I+3]([O-])([O-])[O-] |
| InChI | InChI=1S/IO4.Na.H2O4S/c2-1(3,4)5;;1-5(2,3)4/h;;(H2,1,2,3,4)/q-1;+1; |
| InChIKey | KIIBUOSVQVZIMA-UHFFFAOYSA-N |
| XLogP | -11.40 |
| TPSA | 166.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.97 |
| LogP ≤ 5 | -11.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;sulfuric acid;periodate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;sulfuric acid;periodate?
The IUPAC name of sodium;sulfuric acid;periodate (CID 158009988) is sodium;sulfuric acid;periodate.
What is the SMILES notation for sodium;sulfuric acid;periodate?
The canonical SMILES for sodium;sulfuric acid;periodate is O=S(=O)(O)O.[Na+].[O-][I+3]([O-])([O-])[O-].
What is the InChIKey of sodium;sulfuric acid;periodate?
The InChIKey is KIIBUOSVQVZIMA-UHFFFAOYSA-N. The full InChI is InChI=1S/IO4.Na.H2O4S/c2-1(3,4)5;;1-5(2,3)4/h;;(H2,1,2,3,4)/q-1;+1;.
What are the key properties of sodium;sulfuric acid;periodate?
sodium;sulfuric acid;periodate has a molecular weight of 311.97 g/mol, XLogP of -11.40, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;sulfuric acid;periodate is sourced from PubChem (CID 158009988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).