About dimethyl(methylidene)azanium;methyl(methylidyne)azanium;tetramethylazanium
dimethyl(methylidene)azanium;methyl(methylidyne)azanium;tetramethylazanium (PubChem CID 158011582) has the molecular formula C9H24N3+3
and a molecular weight of 174.31 g/mol. Its IUPAC name is dimethyl(methylidene)azanium;methyl(methylidyne)azanium;tetramethylazanium.
Molecular Properties
| Compound Name | dimethyl(methylidene)azanium;methyl(methylidyne)azanium;tetramethylazanium |
| PubChem CID | 158011582 |
| Molecular Formula | C9H24N3+3 |
| Molecular Weight | 174.31 g/mol |
| Exact Mass | 174.20 |
| IUPAC Name | dimethyl(methylidene)azanium;methyl(methylidyne)azanium;tetramethylazanium |
| SMILES | C#[N+]C.C=[N+](C)C.C[N+](C)(C)C |
| InChI | InChI=1S/C4H12N.C3H8N.C2H4N/c1-5(2,3)4;1-4(2)3;1-3-2/h1-4H3;1H2,2-3H3;1H,2H3/q3*+1 |
| InChIKey | TTXUOLNRTNVQLC-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 7.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.31 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dimethyl(methylidene)azanium;methyl(methylidyne)azanium;tetramethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl(methylidene)azanium;methyl(methylidyne)azanium;tetramethylazanium?
The IUPAC name of dimethyl(methylidene)azanium;methyl(methylidyne)azanium;tetramethylazanium (CID 158011582) is dimethyl(methylidene)azanium;methyl(methylidyne)azanium;tetramethylazanium.
What is the SMILES notation for dimethyl(methylidene)azanium;methyl(methylidyne)azanium;tetramethylazanium?
The canonical SMILES for dimethyl(methylidene)azanium;methyl(methylidyne)azanium;tetramethylazanium is C#[N+]C.C=[N+](C)C.C[N+](C)(C)C.
What is the InChIKey of dimethyl(methylidene)azanium;methyl(methylidyne)azanium;tetramethylazanium?
The InChIKey is TTXUOLNRTNVQLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12N.C3H8N.C2H4N/c1-5(2,3)4;1-4(2)3;1-3-2/h1-4H3;1H2,2-3H3;1H,2H3/q3*+1.
What are the key properties of dimethyl(methylidene)azanium;methyl(methylidyne)azanium;tetramethylazanium?
dimethyl(methylidene)azanium;methyl(methylidyne)azanium;tetramethylazanium has a molecular weight of 174.31 g/mol, XLogP of 0.86, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl(methylidene)azanium;methyl(methylidyne)azanium;tetramethylazanium is sourced from PubChem (CID 158011582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).