About ethane;hydroxy-methyl-methylideneazanium;hydroxy(trimethyl)azanium
ethane;hydroxy-methyl-methylideneazanium;hydroxy(trimethyl)azanium (PubChem CID 159411313) has the molecular formula C7H22N2O2+2
and a molecular weight of 166.26 g/mol. Its IUPAC name is ethane;hydroxy-methyl-methylideneazanium;hydroxy(trimethyl)azanium.
Molecular Properties
| Compound Name | ethane;hydroxy-methyl-methylideneazanium;hydroxy(trimethyl)azanium |
| PubChem CID | 159411313 |
| Molecular Formula | C7H22N2O2+2 |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | ethane;hydroxy-methyl-methylideneazanium;hydroxy(trimethyl)azanium |
| SMILES | C=[N+](C)O.CC.C[N+](C)(C)O |
| InChI | InChI=1S/C3H10NO.C2H6NO.C2H6/c1-4(2,3)5;1-3(2)4;1-2/h5H,1-3H3;4H,1H2,2H3;1-2H3/q2*+1; |
| InChIKey | OEIZKDCMTVCQES-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 43.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;hydroxy-methyl-methylideneazanium;hydroxy(trimethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;hydroxy-methyl-methylideneazanium;hydroxy(trimethyl)azanium?
The IUPAC name of ethane;hydroxy-methyl-methylideneazanium;hydroxy(trimethyl)azanium (CID 159411313) is ethane;hydroxy-methyl-methylideneazanium;hydroxy(trimethyl)azanium.
What is the SMILES notation for ethane;hydroxy-methyl-methylideneazanium;hydroxy(trimethyl)azanium?
The canonical SMILES for ethane;hydroxy-methyl-methylideneazanium;hydroxy(trimethyl)azanium is C=[N+](C)O.CC.C[N+](C)(C)O.
What is the InChIKey of ethane;hydroxy-methyl-methylideneazanium;hydroxy(trimethyl)azanium?
The InChIKey is OEIZKDCMTVCQES-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10NO.C2H6NO.C2H6/c1-4(2,3)5;1-3(2)4;1-2/h5H,1-3H3;4H,1H2,2H3;1-2H3/q2*+1;.
What are the key properties of ethane;hydroxy-methyl-methylideneazanium;hydroxy(trimethyl)azanium?
ethane;hydroxy-methyl-methylideneazanium;hydroxy(trimethyl)azanium has a molecular weight of 166.26 g/mol, XLogP of 0.83, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;hydroxy-methyl-methylideneazanium;hydroxy(trimethyl)azanium is sourced from PubChem (CID 159411313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).