About ethane;methoxy-methyl-methylideneazanium
ethane;methoxy-methyl-methylideneazanium (PubChem CID 158329110) has the molecular formula C7H20NO+
and a molecular weight of 134.24 g/mol. Its IUPAC name is ethane;methoxy-methyl-methylideneazanium.
Molecular Properties
| Compound Name | ethane;methoxy-methyl-methylideneazanium |
| PubChem CID | 158329110 |
| Molecular Formula | C7H20NO+ |
| Molecular Weight | 134.24 g/mol |
| Exact Mass | 134.15 |
| IUPAC Name | ethane;methoxy-methyl-methylideneazanium |
| SMILES | C=[N+](C)OC.CC.CC |
| InChI | InChI=1S/C3H8NO.2C2H6/c1-4(2)5-3;2*1-2/h1H2,2-3H3;2*1-2H3/q+1;; |
| InChIKey | QTKIWWXHNRBNOY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;methoxy-methyl-methylideneazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methoxy-methyl-methylideneazanium?
The IUPAC name of ethane;methoxy-methyl-methylideneazanium (CID 158329110) is ethane;methoxy-methyl-methylideneazanium.
What is the SMILES notation for ethane;methoxy-methyl-methylideneazanium?
The canonical SMILES for ethane;methoxy-methyl-methylideneazanium is C=[N+](C)OC.CC.CC.
What is the InChIKey of ethane;methoxy-methyl-methylideneazanium?
The InChIKey is QTKIWWXHNRBNOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8NO.2C2H6/c1-4(2)5-3;2*1-2/h1H2,2-3H3;2*1-2H3/q+1;;.
What are the key properties of ethane;methoxy-methyl-methylideneazanium?
ethane;methoxy-methyl-methylideneazanium has a molecular weight of 134.24 g/mol, XLogP of 1.94, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methoxy-methyl-methylideneazanium is sourced from PubChem (CID 158329110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).