C11H17FO4 — CID 158019627
(2S)-2-(4-fluorocyclohexyl)-4-methoxy-4-oxobutanoic acid (PubChem CID 158019627) has the molecular formula C11H17FO4 and a molecular weight of 232.25 g/mol. Its IUPAC name is (2S)-2-(4-fluorocyclohexyl)-4-methoxy-4-oxobutanoic acid.
| Compound Name | (2S)-2-(4-fluorocyclohexyl)-4-methoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 158019627 |
| Molecular Formula | C11H17FO4 |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | (2S)-2-(4-fluorocyclohexyl)-4-methoxy-4-oxobutanoic acid |
| SMILES | COC(=O)C[C@H](C(=O)O)C1CCC(F)CC1 |
| InChI | InChI=1S/C11H17FO4/c1-16-10(13)6-9(11(14)15)7-2-4-8(12)5-3-7/h7-9H,2-6H2,1H3,(H,14,15)/t7?,8?,9-/m0/s1 |
| InChIKey | KRLIBDSWOPFPOL-HACHORDNSA-N |
| XLogP | 1.78 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |